Structure of PDB 5g0t Chain C Binding Site BS02 |
|
|
Ligand ID | S72 |
InChI | InChI=1S/C29H35FN6O3/c1-20-28(33-34-36(20)18-22-6-4-3-5-7-22)29(39)32-25-14-10-21(11-15-25)16-27(38)35(19-26(37)31-2)17-23-8-12-24(30)13-9-23/h3-9,12-13,21,25H,10-11,14-19H2,1-2H3,(H,31,37)(H,32,39)/t21-,25+ |
InChIKey | VLFIXXJBXZWQID-IVHGUIJPSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CNC(=O)CN(Cc1ccc(F)cc1)C(=O)C[C@H]2CC[C@H](CC2)NC(=O)c3nnn(Cc4ccccc4)c3C | OpenEye OEToolkits 1.7.6 | Cc1c(nnn1Cc2ccccc2)C(=O)NC3CCC(CC3)CC(=O)N(Cc4ccc(cc4)F)CC(=O)NC | CACTVS 3.385 | CNC(=O)CN(Cc1ccc(F)cc1)C(=O)C[CH]2CC[CH](CC2)NC(=O)c3nnn(Cc4ccccc4)c3C | ACDLabs 12.01 | Cc1c(nnn1Cc2ccccc2)C(=O)NC3CCC(CC3)CC(=O)N(Cc4ccc(F)cc4)CC(=O)NC |
|
Formula | C29 H35 F N6 O3 |
Name | 1-benzyl-N-[cis-4-(2-{[(4-fluorophenyl)methyl][2-(methylamino)-2-oxoethyl]amino}-2-oxoethyl)cyclohexyl]-5-methyl-1H-1,2,3-triazole-4-carboxamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5g0t Chain C Residue 1271
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
Y158 K165 |
Catalytic site (residue number reindexed from 1) |
Y157 K164 |
Enzyme Commision number |
1.3.1.9: enoyl-[acyl-carrier-protein] reductase (NADH). |
|
|
|