Structure of PDB 5fbn Chain C Binding Site BS02 |
|
|
Ligand ID | 5WE |
InChI | InChI=1S/C26H30N8O2S/c1-32(2)13-4-6-20(35)33-14-3-5-19(33)24-30-21(22-23(27)28-11-15-34(22)24)17-7-9-18(10-8-17)25(36)31-26-29-12-16-37-26/h7-12,15-16,19H,3-6,13-14H2,1-2H3,(H2,27,28)(H,29,31,36)/t19-/m0/s1 |
InChIKey | HUXVNVAKNWKLJM-IBGZPJMESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CN(C)CCCC(=O)N1CCC[C@H]1c2nc(c3ccc(cc3)C(=O)Nc4sccn4)c5n2ccnc5N | OpenEye OEToolkits 2.0.4 | CN(C)CCCC(=O)N1CCC[C@H]1c2nc(c3n2ccnc3N)c4ccc(cc4)C(=O)Nc5nccs5 | CACTVS 3.385 | CN(C)CCCC(=O)N1CCC[CH]1c2nc(c3ccc(cc3)C(=O)Nc4sccn4)c5n2ccnc5N | OpenEye OEToolkits 2.0.4 | CN(C)CCCC(=O)N1CCCC1c2nc(c3n2ccnc3N)c4ccc(cc4)C(=O)Nc5nccs5 |
|
Formula | C26 H30 N8 O2 S |
Name | 4-[8-azanyl-3-[(2~{S})-1-[4-(dimethylamino)butanoyl]pyrrolidin-2-yl]imidazo[1,5-a]pyrazin-1-yl]-~{N}-(1,3-thiazol-2-yl)benzamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000263620535
|
PDB chain | 5fbn Chain C Residue 702
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
N526 D539 |
Catalytic site (residue number reindexed from 1) |
N132 D145 |
Enzyme Commision number |
2.7.10.2: non-specific protein-tyrosine kinase. |
|
|
|