Structure of PDB 5axc Chain C Binding Site BS02 |
|
|
Ligand ID | ARJ |
InChI | InChI=1S/C11H13N5O3/c12-10-7-11(14-3-13-10)16(4-15-7)6-1-5(2-17)8(18)9(6)19/h3-6,9,17,19H,1-2H2,(H2,12,13,14)/t5-,6-,9+/m1/s1 |
InChIKey | CWNCBQJCRSRXGI-KCRUCZTKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | Nc1ncnc2n(cnc12)[C@@H]3C[C@H](CO)C(=O)[C@H]3O | ACDLabs 10.04 | O=C3C(O)C(n1c2ncnc(c2nc1)N)CC3CO | OpenEye OEToolkits 1.5.0 | c1nc(c2c(n1)n(cn2)C3CC(C(=O)C3O)CO)N | CACTVS 3.341 | Nc1ncnc2n(cnc12)[CH]3C[CH](CO)C(=O)[CH]3O | OpenEye OEToolkits 1.5.0 | c1nc(c2c(n1)n(cn2)[C@@H]3C[C@@H](C(=O)[C@H]3O)CO)N |
|
Formula | C11 H13 N5 O3 |
Name | (2S,3R,5R)-3-(6-amino-9H-purin-9-yl)-2-hydroxy-5-(hydroxymethyl)cyclopentanone; 3'-keto-aristeromycin |
ChEMBL | |
DrugBank | |
ZINC | ZINC000005941131
|
PDB chain | 5axc Chain C Residue 503
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.13.2.1: adenosylhomocysteinase. |
|
|
|