Structure of PDB 4zvv Chain C Binding Site BS02 |
|
|
Ligand ID | GN0 |
InChI | InChI=1S/C25H23ClN2O3S2/c26-20-3-1-2-4-22(20)33-23-21(29)15-25(27-24(23)30,18-9-14-32-16-18)17-5-7-19(8-6-17)28-10-12-31-13-11-28/h1-9,14,16,29H,10-13,15H2,(H,27,30)/t25-/m1/s1 |
InChIKey | SUFXXEIVBZJOAP-RUZDIDTESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC1=C(Sc2ccccc2Cl)C(=O)N[C](C1)(c3cscc3)c4ccc(cc4)N5CCOCC5 | OpenEye OEToolkits 2.0.4 | c1ccc(c(c1)SC2=C(CC(NC2=O)(c3ccc(cc3)N4CCOCC4)c5ccsc5)O)Cl | OpenEye OEToolkits 2.0.4 | c1ccc(c(c1)SC2=C(C[C@@](NC2=O)(c3ccc(cc3)N4CCOCC4)c5ccsc5)O)Cl | CACTVS 3.385 | OC1=C(Sc2ccccc2Cl)C(=O)N[C@@](C1)(c3cscc3)c4ccc(cc4)N5CCOCC5 |
|
Formula | C25 H23 Cl N2 O3 S2 |
Name | (2~{R})-5-(2-chlorophenyl)sulfanyl-2-(4-morpholin-4-ylphenyl)-4-oxidanyl-2-thiophen-3-yl-1,3-dihydropyridin-6-one; inhibitor GNE-140 |
ChEMBL | CHEMBL4065858 |
DrugBank | |
ZINC | ZINC000584905559
|
PDB chain | 4zvv Chain C Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|