Structure of PDB 4ufv Chain C Binding Site BS02 |
|
|
Ligand ID | 31A |
InChI | InChI=1S/C21H25N3O3/c1-26-17-6-4-5-15(13-17)14-20(22)24-21(25)18-7-2-3-8-19(18)27-16-9-11-23-12-10-16/h2-8,13,16,23H,9-12,14H2,1H3,(H2,22,24,25) |
InChIKey | WTWXRFGIIFJWMN-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | COc1cccc(c1)CC(=N)NC(=O)c2ccccc2OC3CCNCC3 | CACTVS 3.385 | COc1cccc(CC(=N)NC(=O)c2ccccc2OC3CCNCC3)c1 | ACDLabs 12.01 | O=C(c2c(OC1CCNCC1)cccc2)NC(=[N@H])Cc3cccc(OC)c3 | OpenEye OEToolkits 1.9.2 | [H]/N=C(\Cc1cccc(c1)OC)/NC(=O)c2ccccc2OC3CCNCC3 |
|
Formula | C21 H25 N3 O3 |
Name | N-[2-(3-methoxyphenyl)ethanimidoyl]-2-piperidin-4-yloxy-benzamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000263621197
|
PDB chain | 4ufv Chain C Residue 1001
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|