Structure of PDB 4r68 Chain C Binding Site BS02 |
|
|
Ligand ID | W31 |
InChI | InChI=1S/C28H23Cl3O4S/c1-16(18-6-3-2-4-7-18)35-26(34)13-17-10-11-20(29)25(12-17)36-28-23(32)14-19(15-24(28)33)27-21(30)8-5-9-22(27)31/h2-12,16,19,32H,13-15H2,1H3/t16-,19-/m0/s1 |
InChIKey | SGKXXAIIXVXKBG-LPHOPBHVSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[C@H](OC(=O)Cc1ccc(Cl)c(SC2=C(O)C[C@@H](CC2=O)c3c(Cl)cccc3Cl)c1)c4ccccc4 | OpenEye OEToolkits 1.7.6 | C[C@@H](c1ccccc1)OC(=O)Cc2ccc(c(c2)SC3=C(C[C@@H](CC3=O)c4c(cccc4Cl)Cl)O)Cl | OpenEye OEToolkits 1.7.6 | CC(c1ccccc1)OC(=O)Cc2ccc(c(c2)SC3=C(CC(CC3=O)c4c(cccc4Cl)Cl)O)Cl | CACTVS 3.385 | C[CH](OC(=O)Cc1ccc(Cl)c(SC2=C(O)C[CH](CC2=O)c3c(Cl)cccc3Cl)c1)c4ccccc4 | ACDLabs 12.01 | O=C(OC(c1ccccc1)C)Cc4cc(SC3=C(O)CC(c2c(Cl)cccc2Cl)CC3=O)c(Cl)cc4 |
|
Formula | C28 H23 Cl3 O4 S |
Name | (1S)-1-phenylethyl (4-chloro-3-{[(4S)-4-(2,6-dichlorophenyl)-2-hydroxy-6-oxocyclohex-1-en-1-yl]sulfanyl}phenyl)acetate |
ChEMBL | |
DrugBank | |
ZINC | ZINC000263621036
|
PDB chain | 4r68 Chain C Residue 803
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
D165 R168 H192 |
Catalytic site (residue number reindexed from 1) |
D157 R160 H184 |
Enzyme Commision number |
1.1.1.27: L-lactate dehydrogenase. |
|
|
|