Structure of PDB 4i9i Chain C Binding Site BS02 |
|
|
Ligand ID | 1DY |
InChI | InChI=1S/C25H22N4O4/c1-33-21-9-5-4-8-20(21)28-24(31)16-10-12-17(13-11-16)26-23(30)15-14-22-27-19-7-3-2-6-18(19)25(32)29-22/h2-13H,14-15H2,1H3,(H,26,30)(H,28,31)(H,27,29,32) |
InChIKey | WWKKOAKRYQQEBT-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | COc1ccccc1NC(=O)c2ccc(NC(=O)CCC3=Nc4ccccc4C(=O)N3)cc2 | OpenEye OEToolkits 1.7.6 | COc1ccccc1NC(=O)c2ccc(cc2)NC(=O)CCC3=Nc4ccccc4C(=O)N3 | ACDLabs 12.01 | O=C(Nc1ccccc1OC)c2ccc(cc2)NC(=O)CCC4=Nc3c(cccc3)C(=O)N4 |
|
Formula | C25 H22 N4 O4 |
Name | N-(2-methoxyphenyl)-4-{[3-(4-oxo-3,4-dihydroquinazolin-2-yl)propanoyl]amino}benzamide |
ChEMBL | CHEMBL2314698 |
DrugBank | |
ZINC | ZINC000013149824
|
PDB chain | 4i9i Chain C Residue 1402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|