Structure of PDB 4bqr Chain C Binding Site BS02 |
|
|
Ligand ID | IBH |
InChI | InChI=1S/C16H14F2N4O2S2/c1-8-7-25-13(19-8)16(2,24)14-21-22-15(26-14)20-12(23)6-9-10(17)4-3-5-11(9)18/h3-5,7,24H,6H2,1-2H3,(H,20,22,23)/t16-/m0/s1 |
InChIKey | LBTQISHPRWJOLN-INIZCTEOSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | Cc1csc(n1)C(C)(C2=NNC(=NC(=O)Cc3c(cccc3F)F)S2)O | ACDLabs 12.01 | O=C(\N=C1/SC(=NN1)C(O)(c2nc(cs2)C)C)Cc3c(F)cccc3F | OpenEye OEToolkits 1.7.6 | Cc1csc(n1)[C@@](C)(C2=NN/C(=N/C(=O)Cc3c(cccc3F)F)/S2)O | CACTVS 3.370 | Cc1csc(n1)[C](C)(O)C2=NNC(S2)=NC(=O)Cc3c(F)cccc3F | CACTVS 3.370 | Cc1csc(n1)[C@](C)(O)C2=NNC(S2)=NC(=O)Cc3c(F)cccc3F |
|
Formula | C16 H14 F2 N4 O2 S2 |
Name | (NZ)-2-[2,6-bis(fluoranyl)phenyl]-N-[5-[(1S)-1-(4-methyl-1,3-thiazol-2-yl)-1-oxidanyl-ethyl]-3H-1,3,4-thiadiazol-2-ylidene]ethanamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921164
|
PDB chain | 4bqr Chain C Residue 1271
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
Y158 K165 |
Catalytic site (residue number reindexed from 1) |
Y157 K164 |
Enzyme Commision number |
1.3.1.9: enoyl-[acyl-carrier-protein] reductase (NADH). |
|
|
|