Structure of PDB 3zp7 Chain C Binding Site BS02 |
|
|
Ligand ID | ISJ |
InChI | InChI=1S/C10H10O6/c1-5(9(12)13)16-8-4-6(10(14)15)2-3-7(8)11/h2-4,7-8,11H,1H2,(H,12,13)(H,14,15)/t7-,8-/m1/s1 |
InChIKey | WTFXTQVDAKGDEY-HTQZYQBOSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.2 | C=C(C(=O)O)O[C@@H]1C=C(C=C[C@H]1O)C(=O)O | CACTVS 3.370 | O[C@@H]1C=CC(=C[C@H]1OC(=C)C(O)=O)C(O)=O | CACTVS 3.370 | O[CH]1C=CC(=C[CH]1OC(=C)C(O)=O)C(O)=O | ACDLabs 12.01 | O=C(O)C1=CC(O/C(C(=O)O)=C)C(O)C=C1 | OpenEye OEToolkits 1.7.2 | C=C(C(=O)O)OC1C=C(C=CC1O)C(=O)O |
|
Formula | C10 H10 O6 |
Name | (3R,4R)-3-[(1-carboxyethenyl)oxy]-4-hydroxycyclohexa-1,5-diene-1-carboxylic acid; Chorismic Acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000003869471
|
PDB chain | 3zp7 Chain B Residue 1119
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|