Structure of PDB 3mcv Chain C Binding Site BS02 |
|
|
Ligand ID | MCV |
InChI | InChI=1S/C16H18N4O2S/c1-21-11-5-6-12(22-2)9(7-11)3-4-10-8-23-15-13(10)14(17)19-16(18)20-15/h5-8H,3-4H2,1-2H3,(H4,17,18,19,20) |
InChIKey | XJFDLPAAAIBWID-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | COc1ccc(c(c1)CCc2csc3c2c(nc(n3)N)N)OC | CACTVS 3.370 | COc1ccc(OC)c(CCc2csc3nc(N)nc(N)c23)c1 | ACDLabs 12.01 | n1c(c2c(nc1N)scc2CCc3cc(OC)ccc3OC)N |
|
Formula | C16 H18 N4 O2 S |
Name | 5-[2-(2,5-dimethoxyphenyl)ethyl]thieno[2,3-d]pyrimidine-2,4-diamine |
ChEMBL | CHEMBL107023 |
DrugBank | |
ZINC | ZINC000005889010
|
PDB chain | 3mcv Chain C Residue 300
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|