Structure of PDB 3jqb Chain C Binding Site BS02 |
|
|
Ligand ID | DX6 |
InChI | InChI=1S/C14H14N4O/c15-14-17-12-11(13(19)18-14)10(8-16-12)7-6-9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H4,15,16,17,18,19) |
InChIKey | GPZHVIFHNQJWLA-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | O=C1c2c(cnc2N=C(N1)N)CCc3ccccc3 | OpenEye OEToolkits 1.5.0 | c1ccc(cc1)CCc2c[nH]c3c2C(=O)NC(=N3)N | CACTVS 3.341 | NC1=Nc2[nH]cc(CCc3ccccc3)c2C(=O)N1 |
|
Formula | C14 H14 N4 O |
Name | 2-amino-5-(2-phenylethyl)-3,7-dihydro-4H-pyrrolo[2,3-d]pyrimidin-4-one |
ChEMBL | CHEMBL567351 |
DrugBank | |
ZINC | ZINC000036374070
|
PDB chain | 3jqb Chain C Residue 270
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|