Structure of PDB 2vvq Chain C Binding Site BS02 |
|
|
Ligand ID | R10 |
InChI | InChI=1S/C5H11O9P/c6-2(1-14-15(11,12)13)3(7)4(8)5(9)10/h2-4,6-8H,1H2,(H,9,10)(H2,11,12,13)/t2-,3-,4-/m1/s1 |
InChIKey | HNECGPFIYSOYHF-BXXZVTAOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | O[C@H](CO[P](O)(O)=O)[C@@H](O)[C@@H](O)C(O)=O | ACDLabs 10.04 | O=P(O)(O)OCC(O)C(O)C(O)C(=O)O | CACTVS 3.341 | O[CH](CO[P](O)(O)=O)[CH](O)[CH](O)C(O)=O | OpenEye OEToolkits 1.5.0 | C([C@H]([C@H]([C@H](C(=O)O)O)O)O)OP(=O)(O)O | OpenEye OEToolkits 1.5.0 | C(C(C(C(C(=O)O)O)O)O)OP(=O)(O)O |
|
Formula | C5 H11 O9 P |
Name | 5-O-phosphono-D-ribonic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000012502993
|
PDB chain | 2vvq Chain D Residue 200
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|