Structure of PDB 1ww5 Chain C Binding Site BS02 |
|
|
Ligand ID | SGA |
InChI | InChI=1S/C6H12O9S/c7-1-2-3(8)5(15-16(11,12)13)4(9)6(10)14-2/h2-10H,1H2,(H,11,12,13)/t2-,3+,4-,5+,6-/m1/s1 |
InChIKey | HHRMGTRTCHNCRO-FDROIEKHSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | O=S(=O)(OC1C(O)C(OC(O)C1O)CO)O | CACTVS 3.341 | OC[CH]1O[CH](O)[CH](O)[CH](O[S](O)(=O)=O)[CH]1O | CACTVS 3.341 | OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O[S](O)(=O)=O)[C@H]1O | OpenEye OEToolkits 1.5.0 | C(C1C(C(C(C(O1)O)O)OS(=O)(=O)O)O)O | OpenEye OEToolkits 1.5.0 | C([C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)O)O)OS(=O)(=O)O)O)O |
|
Formula | C6 H12 O9 S |
Name | 3-O-sulfo-beta-D-galactopyranose; O3-SULFONYLGALACTOSE; 3-O-sulfo-beta-D-galactose; 3-O-sulfo-D-galactose; 3-O-sulfo-galactose |
ChEMBL | |
DrugBank | DB01818 |
ZINC | ZINC000005829868
|
PDB chain | 1ww5 Chain G Residue 2
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|