Structure of PDB 7pri Chain BBB Binding Site BS02 |
|
|
Ligand ID | 7TI |
InChI | InChI=1S/C8H8Cl3N3O4S2/c9-7(8(10)11)3-1-4(12)6(20(14,17)18)2-5(3)19(13,15)16/h1-2H,12H2,(H2,13,15,16)(H2,14,17,18) |
InChIKey | QOVTVIYTBRHADL-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1c(c(cc(c1N)S(=O)(=O)N)S(=O)(=O)N)C(=C(Cl)Cl)Cl | CACTVS 3.385 | Nc1cc(C(Cl)=C(Cl)Cl)c(cc1[S](N)(=O)=O)[S](N)(=O)=O |
|
Formula | C8 H8 Cl3 N3 O4 S2 |
Name | 4-azanyl-6-[1,2,2-tris(chloranyl)ethenyl]benzene-1,3-disulfonamide; clorsulon |
ChEMBL | CHEMBL1474129 |
DrugBank | DB11389 |
ZINC | ZINC000002001200
|
PDB chain | 7pri Chain BBB Residue 406
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
4.2.1.1: carbonic anhydrase. |
|
|
|