Structure of PDB 8wkr Chain B Binding Site BS02 |
|
|
Ligand ID | LLP |
InChI | InChI=1S/C14H22N3O7P/c1-9-13(18)11(10(6-17-9)8-24-25(21,22)23)7-16-5-3-2-4-12(15)14(19)20/h6-7,12,18H,2-5,8,15H2,1H3,(H,19,20)(H2,21,22,23)/b16-7+/t12-/m0/s1 |
InChIKey | YQSOQJORMNSDJL-QFULYMJESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1ncc(CO[P](O)(O)=O)c(C=NCCCC[CH](N)C(O)=O)c1O | ACDLabs 12.01 | n1c(C)c(O)c(\C=N\CCCCC(N)C(=O)O)c(c1)COP(=O)(O)O | OpenEye OEToolkits 1.7.6 | Cc1c(c(c(cn1)COP(=O)(O)O)/C=N/CCCCC(C(=O)O)N)O | CACTVS 3.385 | Cc1ncc(CO[P](O)(O)=O)c(C=NCCCC[C@H](N)C(O)=O)c1O | OpenEye OEToolkits 1.7.6 | Cc1c(c(c(cn1)COP(=O)(O)O)C=NCCCCC(C(=O)O)N)O |
|
Formula | C14 H22 N3 O7 P |
Name | (2S)-2-amino-6-[[3-hydroxy-2-methyl-5-(phosphonooxymethyl)pyridin-4-yl]methylideneamino]hexanoic acid; N'-PYRIDOXYL-LYSINE-5'-MONOPHOSPHATE |
ChEMBL | |
DrugBank | DB04083 |
ZINC | ZINC000034150380
|
PDB chain | 8wkr Chain B Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|