Structure of PDB 8tnr Chain B Binding Site BS02 |
|
|
Ligand ID | MIQ |
InChI | InChI=1S/C17H17N3O5/c21-14-4-3-13(15(22)18-14)20-16(23)11-2-1-10(9-12(11)17(20)24)19-5-7-25-8-6-19/h1-2,9,13H,3-8H2,(H,18,21,22)/t13-/m0/s1 |
InChIKey | CCCSRHUSXCBFJZ-ZDUSSCGKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1cc2c(cc1N3CCOCC3)C(=O)N(C2=O)C4CCC(=O)NC4=O | ACDLabs 12.01 | O=C1NC(=O)CCC1N1C(=O)c2cc(ccc2C1=O)N1CCOCC1 | OpenEye OEToolkits 2.0.7 | c1cc2c(cc1N3CCOCC3)C(=O)N(C2=O)[C@H]4CCC(=O)NC4=O | CACTVS 3.385 | O=C1CC[CH](N2C(=O)c3ccc(cc3C2=O)N4CCOCC4)C(=O)N1 | CACTVS 3.385 | O=C1CC[C@H](N2C(=O)c3ccc(cc3C2=O)N4CCOCC4)C(=O)N1 |
|
Formula | C17 H17 N3 O5 |
Name | 2-[(3S)-2,6-dioxopiperidin-3-yl]-5-(morpholin-4-yl)-1H-isoindole-1,3(2H)-dione |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8tnr Chain B Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
Biological Process |
GO:0016567 |
protein ubiquitination |
GO:0030177 |
positive regulation of Wnt signaling pathway |
GO:0031333 |
negative regulation of protein-containing complex assembly |
GO:0031334 |
positive regulation of protein-containing complex assembly |
GO:0034766 |
negative regulation of monoatomic ion transmembrane transport |
GO:0035641 |
locomotory exploration behavior |
GO:0043161 |
proteasome-mediated ubiquitin-dependent protein catabolic process |
GO:1902607 |
negative regulation of large conductance calcium-activated potassium channel activity |
|
|