Structure of PDB 8ou3 Chain B Binding Site BS02 |
|
|
Ligand ID | W1T |
InChI | InChI=1S/C12H12FN3O3/c13-8-5-6(14)1-2-7(8)11(18)15-9-3-4-10(17)16-12(9)19/h1-2,5,9H,3-4,14H2,(H,15,18)(H,16,17,19)/t9-/m0/s1 |
InChIKey | PDXLABFIWQGDLW-VIFPVBQESA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1cc(c(cc1N)F)C(=O)N[C@H]2CCC(=O)NC2=O | CACTVS 3.385 | Nc1ccc(c(F)c1)C(=O)N[CH]2CCC(=O)NC2=O | OpenEye OEToolkits 2.0.7 | c1cc(c(cc1N)F)C(=O)NC2CCC(=O)NC2=O | CACTVS 3.385 | Nc1ccc(c(F)c1)C(=O)N[C@H]2CCC(=O)NC2=O |
|
Formula | C12 H12 F N3 O3 |
Name | 4-azanyl-~{N}-[(3~{S})-2,6-bis(oxidanylidene)piperidin-3-yl]-2-fluoranyl-benzamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8ou3 Chain B Residue 202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|