Structure of PDB 8oi9 Chain B Binding Site BS02 |
|
|
Ligand ID | 38T |
InChI | InChI=1S/C10H14N2O6/c1-4-2-12(10(17)11-8(4)16)9-7(15)6(14)5(3-13)18-9/h2,5-7,9,13-15H,3H2,1H3,(H,11,16,17)/t5-,6-,7-,9-/m1/s1 |
InChIKey | DWRXFEITVBNRMK-JXOAFFINSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC1=CN(C(=O)NC1=O)C2C(C(C(O2)CO)O)O | CACTVS 3.385 | CC1=CN([CH]2O[CH](CO)[CH](O)[CH]2O)C(=O)NC1=O | OpenEye OEToolkits 1.7.6 | CC1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O | CACTVS 3.385 | CC1=CN([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C(=O)NC1=O | ACDLabs 12.01 | O=C1NC(=O)N(C=C1C)C2OC(C(O)C2O)CO |
|
Formula | C10 H14 N2 O6 |
Name | 5-methyluridine |
ChEMBL | CHEMBL106175 |
DrugBank | |
ZINC | ZINC000002583634
|
PDB chain | 8oi9 Chain B Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|