Structure of PDB 8g66 Chain B Binding Site BS02 |
|
|
Ligand ID | YOT |
InChI | InChI=1S/C20H16N4O4/c25-17-8-7-15(19(26)22-17)24-10-11-9-12(5-6-13(11)20(24)27)21-18-14-3-1-2-4-16(14)28-23-18/h1-6,9,15H,7-8,10H2,(H,21,23)(H,22,25,26)/t15-/m0/s1 |
InChIKey | AJUZTJBGJWQZFW-HNNXBMFYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | O=C1CC[C@H](N2Cc3cc(Nc4noc5ccccc45)ccc3C2=O)C(=O)N1 | CACTVS 3.385 | O=C1CC[CH](N2Cc3cc(Nc4noc5ccccc45)ccc3C2=O)C(=O)N1 | OpenEye OEToolkits 2.0.7 | c1ccc2c(c1)c(no2)Nc3ccc4c(c3)CN(C4=O)C5CCC(=O)NC5=O | OpenEye OEToolkits 2.0.7 | c1ccc2c(c1)c(no2)Nc3ccc4c(c3)CN(C4=O)[C@H]5CCC(=O)NC5=O | ACDLabs 12.01 | O=C1NC(=O)CCC1N1Cc2cc(ccc2C1=O)Nc1noc2ccccc21 |
|
Formula | C20 H16 N4 O4 |
Name | (3S)-3-{5-[(1,2-benzoxazol-3-yl)amino]-1-oxo-1,3-dihydro-2H-isoindol-2-yl}piperidine-2,6-dione |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8g66 Chain B Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
Biological Process |
GO:0016567 |
protein ubiquitination |
GO:0030177 |
positive regulation of Wnt signaling pathway |
GO:0031333 |
negative regulation of protein-containing complex assembly |
GO:0031334 |
positive regulation of protein-containing complex assembly |
GO:0034766 |
negative regulation of monoatomic ion transmembrane transport |
GO:0035641 |
locomotory exploration behavior |
GO:0043161 |
proteasome-mediated ubiquitin-dependent protein catabolic process |
GO:1902607 |
negative regulation of large conductance calcium-activated potassium channel activity |
|
|