Structure of PDB 8g4x Chain B Binding Site BS02 |
|
|
Ligand ID | Y4B |
InChI | InChI=1S/C21H34O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h14-19,23H,4-12H2,1-3H3/t14-,15+,16-,17+,18-,19-,20-,21+/m0/s1 |
InChIKey | AURFZBICLPNKBZ-SYBPFIFISA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CC(=O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@@H]4[C@@]3(CC[C@H](C4)O)C)C | CACTVS 3.385 | CC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C | CACTVS 3.385 | CC(=O)[CH]1CC[CH]2[CH]3CC[CH]4C[CH](O)CC[C]4(C)[CH]3CC[C]12C | ACDLabs 12.01 | CC(=O)C1CCC2C3CCC4CC(O)CCC4(C)C3CCC12C | OpenEye OEToolkits 2.0.7 | CC(=O)C1CCC2C1(CCC3C2CCC4C3(CCC(C4)O)C)C |
|
Formula | C21 H34 O2 |
Name | allopregnanolone; 3beta-hydroxy-5beta,10alpha,14beta,17alpha-pregnan-20-one; Brexanolone |
ChEMBL | CHEMBL207538 |
DrugBank | DB11859 |
ZINC | ZINC000004081043
|
PDB chain | 8g4x Chain C Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|