Structure of PDB 8d7u Chain B Binding Site BS02 |
|
|
Ligand ID | QFC |
InChI | InChI=1S/C32H30FN5O4/c33-26-16-23(17-34)8-9-27(26)37-14-12-36(13-15-37)18-21-4-6-22(7-5-21)20-42-29-3-1-2-24-25(29)19-38(32(24)41)28-10-11-30(39)35-31(28)40/h1-9,16,28H,10-15,18-20H2,(H,35,39,40)/t28-/m0/s1 |
InChIKey | YTINZZFBHWSAGL-NDEPHWFRSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Fc1cc(ccc1N2CCN(CC2)Cc3ccc(COc4cccc5C(=O)N(Cc45)[C@H]6CCC(=O)NC6=O)cc3)C#N | OpenEye OEToolkits 2.0.7 | c1cc2c(c(c1)OCc3ccc(cc3)CN4CCN(CC4)c5ccc(cc5F)C#N)CN(C2=O)C6CCC(=O)NC6=O | ACDLabs 12.01 | O=C1NC(=O)CCC1N1Cc2c(cccc2OCc2ccc(cc2)CN2CCN(CC2)c2ccc(C#N)cc2F)C1=O | CACTVS 3.385 | Fc1cc(ccc1N2CCN(CC2)Cc3ccc(COc4cccc5C(=O)N(Cc45)[CH]6CCC(=O)NC6=O)cc3)C#N | OpenEye OEToolkits 2.0.7 | c1cc2c(c(c1)OCc3ccc(cc3)CN4CCN(CC4)c5ccc(cc5F)C#N)CN(C2=O)[C@H]6CCC(=O)NC6=O |
|
Formula | C32 H30 F N5 O4 |
Name | Mezigdomide |
ChEMBL | CHEMBL4648616 |
DrugBank | DB17584 |
ZINC |
|
PDB chain | 8d7u Chain B Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
Biological Process |
GO:0016567 |
protein ubiquitination |
GO:0030177 |
positive regulation of Wnt signaling pathway |
GO:0031333 |
negative regulation of protein-containing complex assembly |
GO:0031334 |
positive regulation of protein-containing complex assembly |
GO:0034766 |
negative regulation of monoatomic ion transmembrane transport |
GO:0035641 |
locomotory exploration behavior |
GO:0043161 |
proteasome-mediated ubiquitin-dependent protein catabolic process |
GO:1902607 |
negative regulation of large conductance calcium-activated potassium channel activity |
|
|