Structure of PDB 7tte Chain B Binding Site BS02 |
|
|
Ligand ID | JVR |
InChI | InChI=1S/C19H21N5O2/c1-26-12-7-8-16-15(9-12)21-17(25)10-24(16)18-13-3-2-4-14(13)22-19(23-18)20-11-5-6-11/h7-9,11H,2-6,10H2,1H3,(H,21,25)(H,20,22,23) |
InChIKey | PQVFTRMKRDTVIW-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | COc1ccc2c(NC(=O)CN2c2nc(NC3CC3)nc3CCCc32)c1 | OpenEye OEToolkits 2.0.7 | COc1ccc2c(c1)NC(=O)CN2c3c4c(nc(n3)NC5CC5)CCC4 | CACTVS 3.385 | COc1ccc2N(CC(=O)Nc2c1)c3nc(NC4CC4)nc5CCCc35 |
|
Formula | C19 H21 N5 O2 |
Name | 4-[2-(cyclopropylamino)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]-7-methoxy-3,4-dihydroquinoxalin-2(1H)-one |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7tte Chain B Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|