Structure of PDB 7p0p Chain B Binding Site BS02 |
|
|
Ligand ID | 49I |
InChI | InChI=1S/C22H19NO3S/c24-20(15-7-2-1-3-8-15)23-21-19(22(25)26)18(13-27-21)17-11-10-14-6-4-5-9-16(14)12-17/h1-9,13,17H,10-12H2,(H,23,24)(H,25,26)/t17-/m1/s1 |
InChIKey | ITAWNUSVGMPVHR-QGZVFWFLSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC(=O)c1c(NC(=O)c2ccccc2)scc1[C@@H]3CCc4ccccc4C3 | CACTVS 3.385 | OC(=O)c1c(NC(=O)c2ccccc2)scc1[CH]3CCc4ccccc4C3 | OpenEye OEToolkits 2.0.7 | c1ccc(cc1)C(=O)Nc2c(c(cs2)[C@@H]3CCc4ccccc4C3)C(=O)O | OpenEye OEToolkits 2.0.7 | c1ccc(cc1)C(=O)Nc2c(c(cs2)C3CCc4ccccc4C3)C(=O)O |
|
Formula | C22 H19 N O3 S |
Name | 2-benzamido-4-[(2~{R})-1,2,3,4-tetrahydronaphthalen-2-yl]thiophene-3-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 7p0p Chain D Residue 202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|