Structure of PDB 7ni3 Chain B Binding Site BS02 |
|
|
Ligand ID | UE8 |
InChI | InChI=1S/C10H12N4O2S/c15-9-7-8(12-5-11-7)14(10(17)13-9)4-6-2-1-3-16-6/h5-6H,1-4H2,(H,11,12)(H,13,15,17)/t6-/m1/s1 |
InChIKey | RSPDBEVKURKEII-ZCFIWIBFSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | O=C1NC(=S)N(C[CH]2CCCO2)c3[nH]cnc13 | CACTVS 3.385 | O=C1NC(=S)N(C[C@H]2CCCO2)c3[nH]cnc13 | OpenEye OEToolkits 2.0.7 | c1[nH]c2c(n1)C(=O)NC(=S)N2C[C@H]3CCCO3 | OpenEye OEToolkits 2.0.7 | c1[nH]c2c(n1)C(=O)NC(=S)N2CC3CCCO3 |
|
Formula | C10 H12 N4 O2 S |
Name | 2-sulfanylidene-3-[(2R)-tetrahydro-2-furanylmethyl]-1,2,3,7-tetrahydro-6H-purin-6-one; 3-[[(2~{R})-oxolan-2-yl]methyl]-2-sulfanylidene-9~{H}-purin-6-one |
ChEMBL | CHEMBL4278946 |
DrugBank | |
ZINC | ZINC000038437163
|
PDB chain | 7ni3 Chain D Residue 2201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.11.2.2: myeloperoxidase. |
|
|
|