Structure of PDB 7lz8 Chain B Binding Site BS02 |
|
|
Ligand ID | YJ4 |
InChI | InChI=1S/C18H18N6O2/c1-3-19-18-22-12-5-4-8-20-16(12)17(23-18)24-10-15(25)21-13-9-11(26-2)6-7-14(13)24/h4-9H,3,10H2,1-2H3,(H,21,25)(H,19,22,23) |
InChIKey | FLLCARSUVGNNTL-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CCNc1nc2cccnc2c(n1)N3CC(=O)Nc4c3ccc(c4)OC | CACTVS 3.385 | CCNc1nc2cccnc2c(n1)N3CC(=O)Nc4cc(OC)ccc34 | ACDLabs 12.01 | CCNc1nc2cccnc2c(n1)N1CC(=O)Nc2cc(ccc21)OC |
|
Formula | C18 H18 N6 O2 |
Name | 4-[2-(ethylamino)pyrido[3,2-d]pyrimidin-4-yl]-7-methoxy-3,4-dihydroquinoxalin-2(1H)-one |
ChEMBL | CHEMBL4871913 |
DrugBank | |
ZINC |
|
PDB chain | 7lz8 Chain B Residue 506
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|