Structure of PDB 7bxq Chain B Binding Site BS02 |
|
|
Ligand ID | 2BK |
InChI | InChI=1S/C12H19N2O8P/c1-6-11(16)9(4-14-10(7(2)15)12(17)18)8(3-13-6)5-22-23(19,20)21/h3,7,10,14-16H,4-5H2,1-2H3,(H,17,18)(H2,19,20,21)/t7-,10-/m0/s1 |
InChIKey | IZWQBQLGLAKRMN-XVKPBYJWSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[C@H](O)[C@H](NCc1c(O)c(C)ncc1CO[P](O)(O)=O)C(O)=O | OpenEye OEToolkits 1.7.6 | Cc1c(c(c(cn1)COP(=O)(O)O)CNC(C(C)O)C(=O)O)O | OpenEye OEToolkits 1.7.6 | Cc1c(c(c(cn1)COP(=O)(O)O)CN[C@@H]([C@H](C)O)C(=O)O)O | ACDLabs 12.01 | O=C(O)C(NCc1c(cnc(c1O)C)COP(=O)(O)O)C(O)C | CACTVS 3.385 | C[CH](O)[CH](NCc1c(O)c(C)ncc1CO[P](O)(O)=O)C(O)=O |
|
Formula | C12 H19 N2 O8 P |
Name | N-({3-hydroxy-2-methyl-5-[(phosphonooxy)methyl]pyridin-4-yl}methyl)-L-allothreonine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000002047762
|
PDB chain | 7bxq Chain B Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.3.1.29: glycine C-acetyltransferase. |
|
|
|