Structure of PDB 7aos Chain B Binding Site BS02 |
|
|
Ligand ID | EQN |
InChI | InChI=1S/C22H25NO3/c1-21(2)11-12-22(3,4)18-13-15(7-10-17(18)21)19(24)23-16-8-5-14(6-9-16)20(25)26/h5-10,13H,11-12H2,1-4H3,(H,23,24)(H,25,26) |
InChIKey | SZWKGOZKRMMLAJ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | CC1(C)CCC(C)(C)c2cc(ccc12)C(=O)Nc3ccc(cc3)C(O)=O | OpenEye OEToolkits 1.7.0 | CC1(CCC(c2c1ccc(c2)C(=O)Nc3ccc(cc3)C(=O)O)(C)C)C |
|
Formula | C22 H25 N O3 |
Name | 4-{[(5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)carbonyl]amino}benzoic acid |
ChEMBL | CHEMBL69367 |
DrugBank | |
ZINC | ZINC000003784077
|
PDB chain | 7aos Chain B Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|