Structure of PDB 7ag6 Chain B Binding Site BS02 |
|
|
Ligand ID | RB8 |
InChI | InChI=1S/C6H12O8S/c7-2-6(10)5(9)4(8)3(14-6)1-15(11,12)13/h3-5,7-10H,1-2H2,(H,11,12,13)/t3-,4-,5+,6-/m1/s1 |
InChIKey | QTQNAYQDKCBJTC-ARQDHWQXSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC[C]1(O)O[CH](C[S](O)(=O)=O)[CH](O)[CH]1O | OpenEye OEToolkits 2.0.7 | C(C1C(C(C(O1)(CO)O)O)O)S(=O)(=O)O | OpenEye OEToolkits 2.0.7 | C([C@@H]1[C@H]([C@@H]([C@](O1)(CO)O)O)O)S(=O)(=O)O | CACTVS 3.385 | OC[C@@]1(O)O[C@H](C[S](O)(=O)=O)[C@@H](O)[C@@H]1O |
|
Formula | C6 H12 O8 S |
Name | 6-deoxy-6-sulfo-D-fructose; [(2~{S},3~{S},4~{S},5~{R})-5-(hydroxymethyl)-3,4,5-tris(oxidanyl)oxolan-2-yl]methanesulfonic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000096095523
|
PDB chain | 7ag6 Chain B Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.7.1.184: sulfofructose kinase. |
|
|
|