Structure of PDB 6tq6 Chain B Binding Site BS02 |
|
|
Ligand ID | NVH |
InChI | InChI=1S/C19H13F3N4O5S2/c1-32(28,29)13-7-12(8-23-9-13)26-19(27)25(10-14-15(21)5-11(20)6-16(14)22)18-17(33(26,30)31)3-2-4-24-18/h2-9H,10H2,1H3 |
InChIKey | LWKUASRJTUZHSJ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[S](=O)(=O)c1cncc(c1)N2C(=O)N(Cc3c(F)cc(F)cc3F)c4ncccc4[S]2(=O)=O | OpenEye OEToolkits 2.0.7 | CS(=O)(=O)c1cc(cnc1)N2C(=O)N(c3c(cccn3)S2(=O)=O)Cc4c(cc(cc4F)F)F |
|
Formula | C19 H13 F3 N4 O5 S2 |
Name | 2-(5-methylsulfonylpyridin-3-yl)-1,1-bis(oxidanylidene)-4-[[2,4,6-tris(fluoranyl)phenyl]methyl]pyrido[2,3-e][1,2,4]thiadiazin-3-one |
ChEMBL | CHEMBL4592653 |
DrugBank | |
ZINC |
|
PDB chain | 6tq6 Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|