Structure of PDB 6to7 Chain B Binding Site BS02 |
|
|
Ligand ID | SUV |
InChI | InChI=1S/C23H23ClN6O2/c1-15-3-5-20(30-25-8-9-26-30)18(13-15)22(31)29-12-11-28(10-7-16(29)2)23-27-19-14-17(24)4-6-21(19)32-23/h3-6,8-9,13-14,16H,7,10-12H2,1-2H3/t16-/m1/s1 |
InChIKey | JYTNQNCOQXFQPK-MRXNPFEDSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(c2cc(ccc2n1nccn1)C)N5C(C)CCN(c3nc4cc(Cl)ccc4o3)CC5 | CACTVS 3.385 | C[C@@H]1CCN(CCN1C(=O)c2cc(C)ccc2n3nccn3)c4oc5ccc(Cl)cc5n4 | OpenEye OEToolkits 1.7.6 | Cc1ccc(c(c1)C(=O)N2CCN(CCC2C)c3nc4cc(ccc4o3)Cl)n5nccn5 | OpenEye OEToolkits 1.7.6 | Cc1ccc(c(c1)C(=O)N2CCN(CC[C@H]2C)c3nc4cc(ccc4o3)Cl)n5nccn5 | CACTVS 3.385 | C[CH]1CCN(CCN1C(=O)c2cc(C)ccc2n3nccn3)c4oc5ccc(Cl)cc5n4 |
|
Formula | C23 H23 Cl N6 O2 |
Name | [(7R)-4-(5-chloro-1,3-benzoxazol-2-yl)-7-methyl-1,4-diazepan-1-yl][5-methyl-2-(2H-1,2,3-triazol-2-yl)phenyl]methanone; suvorexant |
ChEMBL | CHEMBL1083659 |
DrugBank | DB09034 |
ZINC | ZINC000049036447
|
PDB chain | 6to7 Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|