Structure of PDB 6nba Chain B Binding Site BS02 |
|
|
Ligand ID | P1T |
InChI | InChI=1S/C11H15N2O7P/c1-6-10(14)9(4-13-7(2)11(15)16)8(3-12-6)5-20-21(17,18)19/h3,13-14H,2,4-5H2,1H3,(H,15,16)(H2,17,18,19) |
InChIKey | BXUDKFHCAMQSRX-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | Cc1c(c(c(cn1)COP(=O)(O)O)CNC(=C)C(=O)O)O | CACTVS 3.341 | Cc1ncc(CO[P](O)(O)=O)c(CNC(=C)C(O)=O)c1O | ACDLabs 10.04 | O=P(O)(O)OCc1cnc(c(O)c1CNC(=C)/C(=O)O)C |
|
Formula | C11 H15 N2 O7 P |
Name | 2-[({3-HYDROXY-2-METHYL-5-[(PHOSPHONOOXY)METHYL]PYRIDIN-4-YL}METHYL)AMINO]ACRYLIC ACID |
ChEMBL | |
DrugBank | |
ZINC | ZINC000103552502
|
PDB chain | 6nba Chain B Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
4.4.1.1: cystathionine gamma-lyase. 4.4.1.2: homocysteine desulfhydrase. |
|
|
Biological Process |
GO:0006534 |
cysteine metabolic process |
GO:0006629 |
lipid metabolic process |
GO:0018272 |
protein-pyridoxal-5-phosphate linkage via peptidyl-N6-pyridoxal phosphate-L-lysine |
GO:0019343 |
cysteine biosynthetic process via cystathionine |
GO:0019344 |
cysteine biosynthetic process |
GO:0019346 |
transsulfuration |
GO:0030968 |
endoplasmic reticulum unfolded protein response |
GO:0043066 |
negative regulation of apoptotic process |
GO:0043123 |
positive regulation of canonical NF-kappaB signal transduction |
GO:0044524 |
protein sulfhydration |
GO:0051092 |
positive regulation of NF-kappaB transcription factor activity |
GO:0051289 |
protein homotetramerization |
GO:0070814 |
hydrogen sulfide biosynthetic process |
GO:1904831 |
positive regulation of aortic smooth muscle cell differentiation |
GO:1990830 |
cellular response to leukemia inhibitory factor |
GO:2001234 |
negative regulation of apoptotic signaling pathway |
|
|