Structure of PDB 6jeu Chain B Binding Site BS02 |
|
|
Ligand ID | K1U |
InChI | InChI=1S/C19H18O4S/c20-17(15-9-5-2-6-10-15)13-24-19(23)16(12-18(21)22)11-14-7-3-1-4-8-14/h1-10,16H,11-13H2,(H,21,22)/t16-/m1/s1 |
InChIKey | XBDWLLDIBQGWMW-MRXNPFEDSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | c1ccc(cc1)C[C@H](CC(=O)O)C(=O)SCC(=O)c2ccccc2 | CACTVS 3.385 | OC(=O)C[C@@H](Cc1ccccc1)C(=O)SCC(=O)c2ccccc2 | ACDLabs 12.01 | OC(CC(Cc1ccccc1)C(=O)SCC(=O)c2ccccc2)=O | CACTVS 3.385 | OC(=O)C[CH](Cc1ccccc1)C(=O)SCC(=O)c2ccccc2 | OpenEye OEToolkits 2.0.6 | c1ccc(cc1)CC(CC(=O)O)C(=O)SCC(=O)c2ccccc2 |
|
Formula | C19 H18 O4 S |
Name | (3R)-3-benzyl-4-oxo-4-[(2-oxo-2-phenylethyl)sulfanyl]butanoic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6jeu Chain B Residue 202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|