Structure of PDB 6hky Chain B Binding Site BS02 |
|
|
Ligand ID | GCE |
InChI | InChI=1S/C20H22F2N4O2S/c1-25(28-2)19(27)26-20(11-6-12-23,14-7-4-3-5-8-14)29-18(24-26)16-13-15(21)9-10-17(16)22/h3-5,7-10,13H,6,11-12,23H2,1-2H3/t20-/m0/s1 |
InChIKey | LLXISKGBWFTGEI-FQEVSTJZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CON(C)C(=O)N1N=C(S[C]1(CCCN)c2ccccc2)c3cc(F)ccc3F | OpenEye OEToolkits 2.0.6 | CN(C(=O)N1C(SC(=N1)c2cc(ccc2F)F)(CCCN)c3ccccc3)OC | OpenEye OEToolkits 2.0.6 | CN(C(=O)N1[C@](SC(=N1)c2cc(ccc2F)F)(CCCN)c3ccccc3)OC | CACTVS 3.385 | CON(C)C(=O)N1N=C(S[C@@]1(CCCN)c2ccccc2)c3cc(F)ccc3F |
|
Formula | C20 H22 F2 N4 O2 S |
Name | (2~{S})-2-(3-azanylpropyl)-5-[2,5-bis(fluoranyl)phenyl]-~{N}-methoxy-~{N}-methyl-2-phenyl-1,3,4-thiadiazole-3-carboxamide |
ChEMBL | CHEMBL2347655 |
DrugBank | DB06040 |
ZINC | ZINC000043204022
|
PDB chain | 6hky Chain B Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|