Structure of PDB 6gf3 Chain B Binding Site BS02 |
|
|
Ligand ID | EX5 |
InChI | InChI=1S/C24H28N2O6/c1-5-23-10-13(21(28)30-4)19-24(6-7-26(22(23)24)11-18-20(23)32-18)14-8-17(31-12(2)27)16(29-3)9-15(14)25-19/h8-9,18,20,22,25H,5-7,10-11H2,1-4H3/t18-,20-,22-,23+,24-/m0/s1 |
InChIKey | ZWUDUCJVIQMXIN-YOQJOLSQSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CCC12CC(=C3C4(C1N(CC4)CC5C2O5)c6cc(c(cc6N3)OC)OC(=O)C)C(=O)OC | CACTVS 3.385 | CC[C@@]12CC(=C3Nc4cc(OC)c(OC(C)=O)cc4[C@@]35CCN(C[C@@H]6O[C@H]16)[C@@H]25)C(=O)OC | OpenEye OEToolkits 2.0.7 | CC[C@]12CC(=C3[C@@]4([C@H]1N(CC4)C[C@H]5[C@@H]2O5)c6cc(c(cc6N3)OC)OC(=O)C)C(=O)OC | CACTVS 3.385 | CC[C]12CC(=C3Nc4cc(OC)c(OC(C)=O)cc4[C]35CCN(C[CH]6O[CH]16)[CH]25)C(=O)OC |
|
Formula | C24 H28 N2 O6 |
Name | Jerantinine B |
ChEMBL | CHEMBL524485 |
DrugBank | |
ZINC | ZINC000040424181
|
PDB chain | 6gf3 Chain B Residue 503
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|