Structure of PDB 6g5u Chain B Binding Site BS02 |
|
|
Ligand ID | ENN |
InChI | InChI=1S/C11H14Cl2N2O3S/c1-2-3-4-15-11(16)7-5-10(19(14,17)18)9(13)6-8(7)12/h5-6H,2-4H2,1H3,(H,15,16)(H2,14,17,18) |
InChIKey | KRIUYRKSVUBELV-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CCCCNC(=O)c1cc(c(cc1Cl)Cl)S(=O)(=O)N | CACTVS 3.385 | CCCCNC(=O)c1cc(c(Cl)cc1Cl)[S](N)(=O)=O |
|
Formula | C11 H14 Cl2 N2 O3 S |
Name | ~{N}-butyl-2,4-bis(chloranyl)-5-sulfamoyl-benzamide |
ChEMBL | CHEMBL4160149 |
DrugBank | |
ZINC | ZINC000027489295
|
PDB chain | 6g5u Chain B Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|