Structure of PDB 6g3v Chain B Binding Site BS02 |
|
|
|
| Ligand ID | FO9 |
| InChI | InChI=1S/C8H17N7O2S3/c9-6(15-20(12,16)17)1-2-18-3-5-4-19-8(13-5)14-7(10)11/h19H,1-4H2,(H2,9,15)(H4,10,11,14)(H2,12,16,17) |
| InChIKey | YFGRAZUYIUBWJO-UHFFFAOYSA-N |
| SMILES | | Software | SMILES |
|---|
| OpenEye OEToolkits 2.0.6 | C1C(=NC(=S1)N=C(N)N)CSCCC(=NS(=O)(=O)N)N | | CACTVS 3.385 | NC(N)=NC1=[SH]CC(=N1)CSCCC(N)=N[S](N)(=O)=O | | OpenEye OEToolkits 2.0.6 | C1C(=NC(=S1)N=C(N)N)CSCC/C(=N/S(=O)(=O)N)/N |
|
| Formula | C8 H17 N7 O2 S3 |
| Name | famotidine |
| ChEMBL | |
| DrugBank | |
| ZINC |
|
| PDB chain | 6g3v Chain B Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|
|
|
|
|
