Structure of PDB 6csd Chain B Binding Site BS02 |
|
|
Ligand ID | PN0 |
InChI | InChI=1S/C18H21N3O5S2/c1-18(2)16(17(22)20-23)21(11-12-27-18)28(24,25)15-5-3-13(4-6-15)26-14-7-9-19-10-8-14/h3-10,16,23H,11-12H2,1-2H3,(H,20,22)/t16-/m0/s1 |
InChIKey | YKPYIPVDTNNYCN-INIZCTEOSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | CC1(C(N(CCS1)S(=O)(=O)c2ccc(cc2)Oc3ccncc3)C(=O)NO)C | ACDLabs 12.01 | O=S(=O)(N1C(C(=O)NO)C(SCC1)(C)C)c3ccc(Oc2ccncc2)cc3 | CACTVS 3.370 | CC1(C)SCCN([C@H]1C(=O)NO)[S](=O)(=O)c2ccc(Oc3ccncc3)cc2 | OpenEye OEToolkits 1.7.0 | CC1([C@@H](N(CCS1)S(=O)(=O)c2ccc(cc2)Oc3ccncc3)C(=O)NO)C | CACTVS 3.370 | CC1(C)SCCN([CH]1C(=O)NO)[S](=O)(=O)c2ccc(Oc3ccncc3)cc2 |
|
Formula | C18 H21 N3 O5 S2 |
Name | Prinomastat; (3S)-N-hydroxy-2,2-dimethyl-4-{[4-(pyridin-4-yloxy)phenyl]sulfonyl}thiomorpholine-3-carboxamide |
ChEMBL | CHEMBL75094 |
DrugBank | DB05100 |
ZINC | ZINC000000580328
|
PDB chain | 6csd Chain B Residue 602
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
Molecular Function |
GO:0004497 |
monooxygenase activity |
GO:0005506 |
iron ion binding |
GO:0016491 |
oxidoreductase activity |
GO:0016705 |
oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen |
GO:0016712 |
oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced flavin or flavoprotein as one donor, and incorporation of one atom of oxygen |
GO:0020037 |
heme binding |
GO:0046872 |
metal ion binding |
GO:0062187 |
anandamide 8,9 epoxidase activity |
GO:0062188 |
anandamide 11,12 epoxidase activity |
GO:0062189 |
anandamide 14,15 epoxidase activity |
|
|