Structure of PDB 5vmp Chain B Binding Site BS02 |
|
|
Ligand ID | 9FJ |
InChI | InChI=1S/C18H20N2O3/c1-23-14-5-6-15-12(9-14)3-2-4-13(15)10-20-17-11-19-8-7-16(17)18(21)22/h5-9,11,13,20H,2-4,10H2,1H3,(H,21,22)/t13-/m0/s1 |
InChIKey | NXQKMWGCRMQRSS-ZDUSSCGKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | COc1ccc2c(c1)CCCC2CNc3cnccc3C(=O)O | OpenEye OEToolkits 2.0.6 | COc1ccc2c(c1)CCC[C@H]2CNc3cnccc3C(=O)O | CACTVS 3.385 | COc1ccc2[C@@H](CCCc2c1)CNc3cnccc3C(O)=O | ACDLabs 12.01 | O=C(O)c1ccncc1NCC2CCCc3c2ccc(c3)OC | CACTVS 3.385 | COc1ccc2[CH](CCCc2c1)CNc3cnccc3C(O)=O |
|
Formula | C18 H20 N2 O3 |
Name | 3-({[(1R)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]methyl}amino)pyridine-4-carboxylic acid |
ChEMBL | CHEMBL4211946 |
DrugBank | |
ZINC |
|
PDB chain | 5vmp Chain B Residue 503
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|