Structure of PDB 5vgi Chain B Binding Site BS02 |
|
|
Ligand ID | 9DJ |
InChI | InChI=1S/C24H25N3O2/c1-27(19-8-3-2-4-9-19)20-10-11-21-17(14-20)6-5-7-18(21)15-26-23-16-25-13-12-22(23)24(28)29/h2-4,8-14,16,18,26H,5-7,15H2,1H3,(H,28,29)/t18-/m0/s1 |
InChIKey | XSMABFRQESMONQ-SFHVURJKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CN(c1ccccc1)c2ccc3[CH](CCCc3c2)CNc4cnccc4C(O)=O | OpenEye OEToolkits 2.0.6 | CN(c1ccccc1)c2ccc3c(c2)CCCC3CNc4cnccc4C(=O)O | CACTVS 3.385 | CN(c1ccccc1)c2ccc3[C@@H](CCCc3c2)CNc4cnccc4C(O)=O | ACDLabs 12.01 | c1cc(C(O)=O)c(cn1)NCC2CCCc3c2ccc(c3)N(c4ccccc4)C | OpenEye OEToolkits 2.0.6 | CN(c1ccccc1)c2ccc3c(c2)CCC[C@H]3CNc4cnccc4C(=O)O |
|
Formula | C24 H25 N3 O2 |
Name | 3-[({(1R)-6-[methyl(phenyl)amino]-1,2,3,4-tetrahydronaphthalen-1-yl}methyl)amino]pyridine-4-carboxylic acid |
ChEMBL | CHEMBL4216044 |
DrugBank | |
ZINC |
|
PDB chain | 5vgi Chain B Residue 503
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|