Structure of PDB 5ttg Chain B Binding Site BS02 |
|
|
Ligand ID | 7KZ |
InChI | InChI=1S/C22H35N5O2/c1-5-6-7-8-11-23-22-25-18-15-20(29-4)19(28-3)14-17(18)21(26-22)24-16-9-12-27(2)13-10-16/h14-16H,5-13H2,1-4H3,(H2,23,24,25,26) |
InChIKey | ZYNUWSFRZCRKSN-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCCCCCNc1nc(NC2CCN(C)CC2)c3cc(OC)c(OC)cc3n1 | ACDLabs 12.01 | C(CCCC)CNc3nc(NC1CCN(C)CC1)c2cc(c(OC)cc2n3)OC | OpenEye OEToolkits 2.0.6 | CCCCCCNc1nc2cc(c(cc2c(n1)NC3CCN(CC3)C)OC)OC |
|
Formula | C22 H35 N5 O2 |
Name | N4-(1-methylpiperidin-4-yl)-N2-hexyl-6,7-dimethoxyquinazoline-2,4-diamine; N~2~-hexyl-6,7-dimethoxy-N~4~-(1-methylpiperidin-4-yl)quinazoline-2,4-diamine |
ChEMBL | CHEMBL4086403 |
DrugBank | |
ZINC | ZINC000584905484
|
PDB chain | 5ttg Chain B Residue 1302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
Y1155 Y1242 |
Catalytic site (residue number reindexed from 1) |
Y150 Y234 |
Enzyme Commision number |
2.1.1.- 2.1.1.367: [histone H3]-lysine(9) N-methyltransferase. |
|
|
|