Structure of PDB 5r4q Chain B Binding Site BS02 |
|
|
Ligand ID | RW7 |
InChI | InChI=1S/C14H18N2O2/c1-4-9-14(2)13(18)15-11-8-6-5-7-10(11)12(17)16(14)3/h5-8H,4,9H2,1-3H3,(H,15,18)/t14-/m0/s1 |
InChIKey | CNQOZARVGPMUHF-AWEZNQCLSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCC[C]1(C)N(C)C(=O)c2ccccc2NC1=O | ACDLabs 12.01 | N2c1ccccc1C(=O)N(C)C(C)(CCC)C2=O | OpenEye OEToolkits 2.0.6 | CCC[C@]1(C(=O)Nc2ccccc2C(=O)N1C)C | OpenEye OEToolkits 2.0.6 | CCCC1(C(=O)Nc2ccccc2C(=O)N1C)C | CACTVS 3.385 | CCC[C@]1(C)N(C)C(=O)c2ccccc2NC1=O |
|
Formula | C14 H18 N2 O2 |
Name | (3S)-3,4-dimethyl-3-propyl-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5r4q Chain B Residue 305
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|