Structure of PDB 5ov7 Chain B Binding Site BS02 |
|
|
Ligand ID | 6FS |
InChI | InChI=1S/C21H25NO8S/c1-27-15-10-19(29-3)16(20(11-15)30-4)7-8-31(25,26)13-14-5-6-18(28-2)17(9-14)22-12-21(23)24/h5-11,22H,12-13H2,1-4H3,(H,23,24)/b8-7+ |
InChIKey | OWBFCJROIKNMGD-BQYQJAHWSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.4 | COc1ccc(cc1NCC(=O)O)CS(=O)(=O)C=Cc2c(cc(cc2OC)OC)OC | CACTVS 3.385 | COc1cc(OC)c(\C=C\[S](=O)(=O)Cc2ccc(OC)c(NCC(O)=O)c2)c(OC)c1 | OpenEye OEToolkits 2.0.4 | COc1ccc(cc1NCC(=O)O)CS(=O)(=O)/C=C/c2c(cc(cc2OC)OC)OC | CACTVS 3.385 | COc1cc(OC)c(C=C[S](=O)(=O)Cc2ccc(OC)c(NCC(O)=O)c2)c(OC)c1 | ACDLabs 12.01 | c1c(cc(c(c1OC)\C=C\S(Cc2ccc(c(c2)NCC(O)=O)OC)(=O)=O)OC)OC |
|
Formula | C21 H25 N O8 S |
Name | N-[2-methoxy-5-({[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonyl}methyl)phenyl]glycine |
ChEMBL | CHEMBL1241855 |
DrugBank | DB12146 |
ZINC | ZINC000003942646
|
PDB chain | 5ov7 Chain B Residue 504
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|