Structure of PDB 5lp6 Chain B Binding Site BS02 |
|
|
Ligand ID | 71P |
InChI | InChI=1S/C22H25NO5S/c1-12(24)23-16-8-6-13-10-18(26-2)21(27-3)22(28-4)20(13)14-7-9-19(29-5)17(25)11-15(14)16/h7,9-11,16H,6,8H2,1-5H3,(H,23,24)/t16-/m1/s1 |
InChIKey | CMEGANPVAXDBPL-MRXNPFEDSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1cc2CC[C@@H](NC(C)=O)C3=CC(=O)C(=CC=C3c2c(OC)c1OC)SC | OpenEye OEToolkits 2.0.5 | CC(=O)NC1CCc2cc(c(c(c2C3=CC=C(C(=O)C=C13)SC)OC)OC)OC | CACTVS 3.385 | COc1cc2CC[CH](NC(C)=O)C3=CC(=O)C(=CC=C3c2c(OC)c1OC)SC | OpenEye OEToolkits 2.0.5 | CC(=O)N[C@@H]1CCc2cc(c(c(c2C3=CC=C(C(=O)C=C13)SC)OC)OC)OC |
|
Formula | C22 H25 N O5 S |
Name | ~{N}-[(7~{R})-1,2,3-trimethoxy-10-methylsulfanyl-9-oxidanylidene-6,7-dihydro-5~{H}-benzo[a]heptalen-7-yl]ethanamide |
ChEMBL | CHEMBL262394 |
DrugBank | |
ZINC | ZINC000001731696
|
PDB chain | 5lp6 Chain B Residue 504
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|