Structure of PDB 5kcj Chain B Binding Site BS02 |
|
|
Ligand ID | 6RM |
InChI | InChI=1S/C18H17FN2O3S/c1-10-17(15-6-11(15)8-22)21-16(23)7-13(20-18(21)25-10)9-24-14-4-2-12(19)3-5-14/h2-5,7,11,15,22H,6,8-9H2,1H3/t11-,15+/m0/s1 |
InChIKey | CJDCZVBFZVDWJU-XHDPSFHLSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.5 | CC1=C(N2C(=O)C=C(N=C2S1)COc3ccc(cc3)F)C4CC4CO | CACTVS 3.385 | CC1=C([CH]2C[CH]2CO)N3C(=O)C=C(COc4ccc(F)cc4)N=C3S1 | CACTVS 3.385 | CC1=C([C@@H]2C[C@H]2CO)N3C(=O)C=C(COc4ccc(F)cc4)N=C3S1 | OpenEye OEToolkits 2.0.5 | CC1=C(N2C(=O)C=C(N=C2S1)COc3ccc(cc3)F)[C@@H]4C[C@H]4CO |
|
Formula | C18 H17 F N2 O3 S |
Name | 7-[(4-fluoranylphenoxy)methyl]-3-[(1~{R},2~{R})-2-(hydroxymethyl)cyclopropyl]-2-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
ChEMBL | CHEMBL3800265 |
DrugBank | |
ZINC | ZINC000584904924
|
PDB chain | 5kcj Chain B Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|