Structure of PDB 5irx Chain B Binding Site BS02 |
|
|
Ligand ID | 6O8 |
InChI | InChI=1S/C19H38NO8P/c1-6-8-10-12-19(22)28-17(15-25-18(21)11-9-7-2)16-27-29(23,24)26-14-13-20(3,4)5/h17H,6-16H2,1-5H3/p+1/t17-/m0/s1 |
InChIKey | IZTOQGOABQJQQN-KRWDZBQOSA-O |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCCCCC(=O)O[C@@H](COC(=O)CCCC)CO[P](O)(=O)OCC[N+](C)(C)C | ACDLabs 12.01 | CCCCC(OCC(OC(=O)CCCCC)COP(OCC[N+](C)(C)C)(O)=O)=O | OpenEye OEToolkits 2.0.4 | CCCCCC(=O)O[C@@H](COC(=O)CCCC)COP(=O)(O)OCC[N+](C)(C)C | CACTVS 3.385 | CCCCCC(=O)O[CH](COC(=O)CCCC)CO[P](O)(=O)OCC[N+](C)(C)C | OpenEye OEToolkits 2.0.4 | CCCCCC(=O)OC(COC(=O)CCCC)COP(=O)(O)OCC[N+](C)(C)C |
|
Formula | C19 H39 N O8 P |
Name | (4R,7S)-4-hydroxy-N,N,N-trimethyl-4,9-dioxo-7-[(pentanoyloxy)methyl]-3,5,8-trioxa-4lambda~5~-phosphatetradecan-1-aminium |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584904728
|
PDB chain | 5irx Chain B Residue 801
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|