Structure of PDB 5i5x Chain B Binding Site BS02 |
|
|
Ligand ID | 68C |
InChI | InChI=1S/C10H7N5O2S2/c1-4-5-7(16)11-2-12-9(5)19-6(4)8(17)14-10-15-13-3-18-10/h2-3H,1H3,(H,11,12,16)(H,14,15,17) |
InChIKey | CDWYKQOLMLZLKK-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | c31N=CNC(c1c(C)c(C(=O)Nc2scnn2)s3)=O | CACTVS 3.385 | Cc1c(sc2N=CNC(=O)c12)C(=O)Nc3scnn3 | OpenEye OEToolkits 2.0.4 | Cc1c2c(sc1C(=O)Nc3nncs3)N=CNC2=O |
|
Formula | C10 H7 N5 O2 S2 |
Name | 5-methyl-4-oxo-N-(1,3,4-thiadiazol-2-yl)-3,4-dihydrothieno[2,3-d]pyrimidine-6-carboxamide |
ChEMBL | CHEMBL3794222 |
DrugBank | |
ZINC | ZINC000584904683
|
PDB chain | 5i5x Chain B Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
K202 |
Catalytic site (residue number reindexed from 1) |
K201 |
Enzyme Commision number |
2.6.1.42: branched-chain-amino-acid transaminase. |
|
|
|