Structure of PDB 5hne Chain B Binding Site BS02 |
|
|
Ligand ID | EL2 |
InChI | InChI=1S/C25H24BrN5O2S/c1-27-24(32)15-8-9-20-19(13-15)30-23(18-7-2-3-12-28-18)31(20)17-6-4-5-16(14-17)29-25(33)21-10-11-22(26)34-21/h2-3,7-13,16-17H,4-6,14H2,1H3,(H,27,32)(H,29,33)/t16-,17+/m0/s1 |
InChIKey | PGSKODUPOMCUEJ-DLBZAZTESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CNC(=O)c1ccc2n([CH]3CCC[CH](C3)NC(=O)c4sc(Br)cc4)c(nc2c1)c5ccccn5 | OpenEye OEToolkits 2.0.4 | CNC(=O)c1ccc2c(c1)nc(n2[C@@H]3CCC[C@@H](C3)NC(=O)c4ccc(s4)Br)c5ccccn5 | OpenEye OEToolkits 2.0.4 | CNC(=O)c1ccc2c(c1)nc(n2C3CCCC(C3)NC(=O)c4ccc(s4)Br)c5ccccn5 | CACTVS 3.385 | CNC(=O)c1ccc2n([C@@H]3CCC[C@@H](C3)NC(=O)c4sc(Br)cc4)c(nc2c1)c5ccccn5 | ACDLabs 12.01 | CNC(c4ccc3n(C1CCCC(C1)NC(=O)c2ccc(s2)Br)c(nc3c4)c5ccccn5)=O |
|
Formula | C25 H24 Br N5 O2 S |
Name | 1-[(1R,3S)-3-{[(5-bromothiophen-2-yl)carbonyl]amino}cyclohexyl]-N-methyl-2-(pyridin-2-yl)-1H-benzimidazole-5-carboxamide |
ChEMBL | CHEMBL3808902 |
DrugBank | |
ZINC | ZINC000584905544
|
PDB chain | 5hne Chain B Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
K202 |
Catalytic site (residue number reindexed from 1) |
K195 |
Enzyme Commision number |
2.6.1.42: branched-chain-amino-acid transaminase. |
|
|
|