Structure of PDB 5fy8 Chain B Binding Site BS02 |
|
|
Ligand ID | N81 |
InChI | InChI=1S/C6H8O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13)/t2-,4-/m0/s1 |
InChIKey | ODBLHEXUDAPZAU-OKKQSCSOSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C([C@@H]([C@@H](C(=O)O)O)C(=O)O)C(=O)O | ACDLabs 12.01 | OC(C(CC(O)=O)C(O)=O)C(O)=O | CACTVS 3.385 | O[C@@H]([C@H](CC(O)=O)C(O)=O)C(O)=O | OpenEye OEToolkits 1.7.6 | C(C(C(C(=O)O)O)C(=O)O)C(=O)O | CACTVS 3.385 | O[CH]([CH](CC(O)=O)C(O)=O)C(O)=O |
|
Formula | C6 H8 O7 |
Name | 3-carboxy-2,3-dideoxy-D-erythro-pentaric acid |
ChEMBL | |
DrugBank | DB01727 |
ZINC | ZINC000000895175
|
PDB chain | 5fy8 Chain B Residue 1354
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|