Structure of PDB 5fsb Chain B Binding Site BS02 |
|
|
Ligand ID | 6YR |
InChI | InChI=1S/C8H16O4Se/c1-4-5(9)6(10)7(11-2)8(12-4)13-3/h4-10H,1-3H3/t4-,5+,6+,7-,8+/m0/s1 |
InChIKey | JGCHFCAEXBTPJU-FMGWEMOISA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CO[CH]1[CH](O)[CH](O)[CH](C)O[CH]1[Se]C | OpenEye OEToolkits 1.7.6 | CC1C(C(C(C(O1)[Se]C)OC)O)O | OpenEye OEToolkits 1.7.6 | C[C@H]1[C@H]([C@H]([C@@H]([C@H](O1)[Se]C)OC)O)O | CACTVS 3.385 | CO[C@H]1[C@H](O)[C@H](O)[C@H](C)O[C@@H]1[Se]C |
|
Formula | C8 H16 O4 Se |
Name | methyl 1-seleno-2-O-methyl-beta-L-fucopyranoside; 2-O-methyl-methyl-seleno-L-fucopyranoside; methyl 1-seleno-2-O-methyl-beta-L-fucoside; methyl 1-seleno-2-O-methyl-L-fucoside; methyl 1-seleno-2-O-methyl-fucoside |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5fsb Chain B Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|