Structure of PDB 5fpf Chain B Binding Site BS02 |
|
|
Ligand ID | 5ZI |
InChI | InChI=1S/C27H21N5O3/c33-24(15-14-23-30-21-8-2-1-7-20(21)27(35)32-23)29-19-12-10-18(11-13-19)26(34)31-22-9-3-5-17-6-4-16-28-25(17)22/h1-13,16H,14-15H2,(H,29,33)(H,31,34)(H,30,32,35) |
InChIKey | HILQRGHXDPSDBM-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | O=C(CCC1=Nc2ccccc2C(=O)N1)Nc3ccc(cc3)C(=O)Nc4cccc5cccnc45 | OpenEye OEToolkits 1.7.6 | c1ccc2c(c1)C(=O)NC(=N2)CCC(=O)Nc3ccc(cc3)C(=O)Nc4cccc5c4nccc5 |
|
Formula | C27 H21 N5 O3 |
Name | 4-[3-(4-oxo-3,4-dihydroquinazolin-2- yl)propanamido]-N-(quinolin-8-yl)benzamide |
ChEMBL | CHEMBL4098188 |
DrugBank | |
ZINC | ZINC000584905226
|
PDB chain | 5fpf Chain B Residue 2112
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|